C20H30 — CID 173219892
1,2,3,5-tetramethyl-4-[1-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethyl]cyclopenta-1,3-diene (PubChem CID 173219892) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 1,2,3,5-tetramethyl-4-[1-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethyl]cyclopenta-1,3-diene.
| Compound Name | 1,2,3,5-tetramethyl-4-[1-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 173219892 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1,2,3,5-tetramethyl-4-[1-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethyl]cyclopenta-1,3-diene |
| SMILES | CC1=C(C)C(C)C(C(C)C2=C(C)C(C)=C(C)C2C)=C1C |
| InChI | InChI=1S/C20H30/c1-10-11(2)15(6)19(14(10)5)18(9)20-16(7)12(3)13(4)17(20)8/h14,16,18H,1-9H3 |
| InChIKey | AJOAQYONZZNURI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |