About 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride
2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride (PubChem CID 173220429) has the molecular formula C12H26ClNO5S
and a molecular weight of 331.86 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride |
| PubChem CID | 173220429 |
| Molecular Formula | C12H26ClNO5S |
| Molecular Weight | 331.86 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride |
| SMILES | C=C(C)C(=O)O.CCCNCCC(C)(C)S(=O)(=O)O.Cl |
| InChI | InChI=1S/C8H19NO3S.C4H6O2.ClH/c1-4-6-9-7-5-8(2,3)13(10,11)12;1-3(2)4(5)6;/h9H,4-7H2,1-3H3,(H,10,11,12);1H2,2H3,(H,5,6);1H |
| InChIKey | VQEXNFDGQFOVQK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.86 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride?
The IUPAC name of 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride (CID 173220429) is 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride.
What is the SMILES notation for 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride?
The canonical SMILES for 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride is C=C(C)C(=O)O.CCCNCCC(C)(C)S(=O)(=O)O.Cl.
What is the InChIKey of 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride?
The InChIKey is VQEXNFDGQFOVQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO3S.C4H6O2.ClH/c1-4-6-9-7-5-8(2,3)13(10,11)12;1-3(2)4(5)6;/h9H,4-7H2,1-3H3,(H,10,11,12);1H2,2H3,(H,5,6);1H.
What are the key properties of 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride?
2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride has a molecular weight of 331.86 g/mol, XLogP of 2.11, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;2-methyl-4-(propylamino)butane-2-sulfonic acid;hydrochloride is sourced from PubChem (CID 173220429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).