C20H22N2O6S — CID 17322094
dimethyl 5-[2-(2-methoxyphenoxy)ethylcarbamothioylamino]benzene-1,3-dicarboxylate (PubChem CID 17322094) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is dimethyl 5-[2-(2-methoxyphenoxy)ethylcarbamothioylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-(2-methoxyphenoxy)ethylcarbamothioylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 17322094 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | dimethyl 5-[2-(2-methoxyphenoxy)ethylcarbamothioylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)NCCOc2ccccc2OC)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H22N2O6S/c1-25-16-6-4-5-7-17(16)28-9-8-21-20(29)22-15-11-13(18(23)26-2)10-14(12-15)19(24)27-3/h4-7,10-12H,8-9H2,1-3H3,(H2,21,22,29) |
| InChIKey | WCUUMBQLTLKJIV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|