C11H13F13OSi — CID 173221085
(3,4,4,5,5,6,6,7,7,8,9,10,10-tridecafluoro-2-methyldecan-2-yl)oxysilane (PubChem CID 173221085) has the molecular formula C11H13F13OSi and a molecular weight of 436.28 g/mol. Its IUPAC name is (3,4,4,5,5,6,6,7,7,8,9,10,10-tridecafluoro-2-methyldecan-2-yl)oxysilane.
| Compound Name | (3,4,4,5,5,6,6,7,7,8,9,10,10-tridecafluoro-2-methyldecan-2-yl)oxysilane |
|---|---|
| PubChem CID | 173221085 |
| Molecular Formula | C11H13F13OSi |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | (3,4,4,5,5,6,6,7,7,8,9,10,10-tridecafluoro-2-methyldecan-2-yl)oxysilane |
| SMILES | CC(C)(O[SiH3])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C11H13F13OSi/c1-7(2,25-26)6(16)9(19,20)11(23,24)10(21,22)8(17,18)4(13)3(12)5(14)15/h3-6H,1-2,26H3 |
| InChIKey | SQFQDRQITBKJKC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|