C18H26O2 — CID 173221202
2-ethynyl-1,4-bis[(2S)-2-methylbutoxy]benzene (PubChem CID 173221202) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 2-ethynyl-1,4-bis[(2S)-2-methylbutoxy]benzene.
| Compound Name | 2-ethynyl-1,4-bis[(2S)-2-methylbutoxy]benzene |
|---|---|
| PubChem CID | 173221202 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-ethynyl-1,4-bis[(2S)-2-methylbutoxy]benzene |
| SMILES | C#Cc1cc(OC[C@@H](C)CC)ccc1OC[C@@H](C)CC |
| InChI | InChI=1S/C18H26O2/c1-6-14(4)12-19-17-9-10-18(16(8-3)11-17)20-13-15(5)7-2/h3,9-11,14-15H,6-7,12-13H2,1-2,4-5H3/t14-,15-/m0/s1 |
| InChIKey | LGUIVPBKWFYFJV-GJZGRUSLSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|