C44H51N13O13 — CID 173221488
2-benzhydryloxy-N,N-dimethylethanamine;tris(2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid) (PubChem CID 173221488) has the molecular formula C44H51N13O13 and a molecular weight of 969.97 g/mol. Its IUPAC name is 2-benzhydryloxy-N,N-dimethylethanamine;tris(2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid).
| Compound Name | 2-benzhydryloxy-N,N-dimethylethanamine;tris(2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid) |
|---|---|
| PubChem CID | 173221488 |
| Molecular Formula | C44H51N13O13 |
| Molecular Weight | 969.97 g/mol |
| Exact Mass | 969.37 |
| IUPAC Name | 2-benzhydryloxy-N,N-dimethylethanamine;tris(2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid) |
| SMILES | CN(C)CCOC(c1ccccc1)c1ccccc1.Cn1c(=O)c2c(ncn2CC(=O)O)n(C)c1=O.Cn1c(=O)c2c(ncn2CC(=O)O)n(C)c1=O.Cn1c(=O)c2c(ncn2CC(=O)O)n(C)c1=O |
| InChI | InChI=1S/C17H21NO.3C9H10N4O4/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;3*1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15/h3-12,17H,13-14H2,1-2H3;3*4H,3H2,1-2H3,(H,14,15) |
| InChIKey | YLGGXZHMINSVKO-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 309.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.97 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 23 |