About 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride
4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride (PubChem CID 173222689) has the molecular formula C14H21ClN4
and a molecular weight of 280.80 g/mol. Its IUPAC name is 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride.
Molecular Properties
| Compound Name | 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride |
| PubChem CID | 173222689 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride |
| SMILES | CC(Cc1[nH]cc[nH+]1)C(C)Nc1ccc(N)cc1.[Cl-] |
| InChI | InChI=1S/C14H20N4.ClH/c1-10(9-14-16-7-8-17-14)11(2)18-13-5-3-12(15)4-6-13;/h3-8,10-11,18H,9,15H2,1-2H3,(H,16,17);1H |
| InChIKey | BTWCYIZEHTVDHP-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride?
The IUPAC name of 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride (CID 173222689) is 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride.
What is the SMILES notation for 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride?
The canonical SMILES for 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride is CC(Cc1[nH]cc[nH+]1)C(C)Nc1ccc(N)cc1.[Cl-].
What is the InChIKey of 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride?
The InChIKey is BTWCYIZEHTVDHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4.ClH/c1-10(9-14-16-7-8-17-14)11(2)18-13-5-3-12(15)4-6-13;/h3-8,10-11,18H,9,15H2,1-2H3,(H,16,17);1H.
What are the key properties of 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride?
4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride has a molecular weight of 280.80 g/mol, XLogP of -0.91, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[4-(1H-imidazol-3-ium-2-yl)-3-methylbutan-2-yl]benzene-1,4-diamine chloride is sourced from PubChem (CID 173222689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).