3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride

C6H8F2O5S2 — CID 173223704

IUPAC3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride
SMILESO=S(=O)(F)C=CCOCC=CS(=O)(=O)F
InChIInChI=1S/C6H8F2O5S2/c7-14(9,10)5-1-3-13-4-2-6-15(8,11)12/h1-2,5-6H,3-4H2
InChIKeyAGOBSZHLTLTIMU-UHFFFAOYSA-N
MW262.25 g/mol
LogP0.63
Rot. Bonds6

About 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride

3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride (PubChem CID 173223704) has the molecular formula C6H8F2O5S2 and a molecular weight of 262.25 g/mol. Its IUPAC name is 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride.

Molecular Properties

Compound Name3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride
PubChem CID173223704
Molecular FormulaC6H8F2O5S2
Molecular Weight262.25 g/mol
Exact Mass261.98
IUPAC Name3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride
SMILESO=S(=O)(F)C=CCOCC=CS(=O)(=O)F
InChIInChI=1S/C6H8F2O5S2/c7-14(9,10)5-1-3-13-4-2-6-15(8,11)12/h1-2,5-6H,3-4H2
InChIKeyAGOBSZHLTLTIMU-UHFFFAOYSA-N
XLogP0.63
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.25
LogP ≤ 50.63
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride?
The IUPAC name of 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride (CID 173223704) is 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride.
What is the SMILES notation for 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride?
The canonical SMILES for 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride is O=S(=O)(F)C=CCOCC=CS(=O)(=O)F.
What is the InChIKey of 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride?
The InChIKey is AGOBSZHLTLTIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2O5S2/c7-14(9,10)5-1-3-13-4-2-6-15(8,11)12/h1-2,5-6H,3-4H2.
What are the key properties of 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride?
3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride has a molecular weight of 262.25 g/mol, XLogP of 0.63, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorosulfonylprop-2-enoxy)prop-1-ene-1-sulfonyl fluoride is sourced from PubChem (CID 173223704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).