About N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide
N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide (PubChem CID 173224347) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide |
| PubChem CID | 173224347 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C11H16N2O2/c1-8(2)10(14)13-11(15)12-9-6-4-3-5-7-9/h4,6-8H,3,5H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | IVCZMNBMXHFTQW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide?
The IUPAC name of N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide (CID 173224347) is N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide.
What is the SMILES notation for N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide?
The canonical SMILES for N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide is CC(C)C(=O)NC(=O)NC1=CCCC=C1.
What is the InChIKey of N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide?
The InChIKey is IVCZMNBMXHFTQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-8(2)10(14)13-11(15)12-9-6-4-3-5-7-9/h4,6-8H,3,5H2,1-2H3,(H2,12,13,14,15).
What are the key properties of N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide?
N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide has a molecular weight of 208.26 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-1-ylcarbamoyl)-2-methylpropanamide is sourced from PubChem (CID 173224347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).