C23H23N2NaS — CID 173224940
sodium;1-(1,2-dihydroimidazol-3-yl)-2,2,2-triphenylethanethiol;hydride (PubChem CID 173224940) has the molecular formula C23H23N2NaS and a molecular weight of 382.51 g/mol. Its IUPAC name is sodium;1-(1,2-dihydroimidazol-3-yl)-2,2,2-triphenylethanethiol;hydride.
| Compound Name | sodium;1-(1,2-dihydroimidazol-3-yl)-2,2,2-triphenylethanethiol;hydride |
|---|---|
| PubChem CID | 173224940 |
| Molecular Formula | C23H23N2NaS |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | sodium;1-(1,2-dihydroimidazol-3-yl)-2,2,2-triphenylethanethiol;hydride |
| SMILES | SC(N1C=CNC1)C(c1ccccc1)(c1ccccc1)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C23H22N2S.Na.H/c26-22(25-17-16-24-18-25)23(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21;;/h1-17,22,24,26H,18H2;;/q;+1;-1 |
| InChIKey | RKOKDADWKXAIKE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|