C18H17N3O5S — CID 173224978
[[amino-[(2,10-dimethyl-5,5-dioxo-6H-benzo[c]thiochromene-3-carbonyl)amino]methylidene]amino] formate (PubChem CID 173224978) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is [[amino-[(2,10-dimethyl-5,5-dioxo-6H-benzo[c]thiochromene-3-carbonyl)amino]methylidene]amino] formate.
| Compound Name | [[amino-[(2,10-dimethyl-5,5-dioxo-6H-benzo[c]thiochromene-3-carbonyl)amino]methylidene]amino] formate |
|---|---|
| PubChem CID | 173224978 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [[amino-[(2,10-dimethyl-5,5-dioxo-6H-benzo[c]thiochromene-3-carbonyl)amino]methylidene]amino] formate |
| SMILES | Cc1cc2c(cc1C(=O)NC(N)=NOC=O)S(=O)(=O)Cc1cccc(C)c1-2 |
| InChI | InChI=1S/C18H17N3O5S/c1-10-4-3-5-12-8-27(24,25)15-7-13(11(2)6-14(15)16(10)12)17(23)20-18(19)21-26-9-22/h3-7,9H,8H2,1-2H3,(H3,19,20,21,23) |
| InChIKey | PQABMBVRISAZFJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|