C6H6N4O2S2 — CID 173225044
5-[(3-hydroxy-1,2-dihydro-1,2,4-triazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 173225044) has the molecular formula C6H6N4O2S2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-[(3-hydroxy-1,2-dihydro-1,2,4-triazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-hydroxy-1,2-dihydro-1,2,4-triazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 173225044 |
| Molecular Formula | C6H6N4O2S2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 5-[(3-hydroxy-1,2-dihydro-1,2,4-triazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)SC1=CC1(O)N=CNN1 |
| InChI | InChI=1S/C6H6N4O2S2/c11-4-3(14-5(13)9-4)1-6(12)7-2-8-10-6/h1-2,10,12H,(H,7,8)(H,9,11,13) |
| InChIKey | SKGARSWMMXRDRK-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|