About sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride
sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride (PubChem CID 173226136) has the molecular formula C9H11NaO5S
and a molecular weight of 254.24 g/mol. Its IUPAC name is sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride.
Molecular Properties
| Compound Name | sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride |
| PubChem CID | 173226136 |
| Molecular Formula | C9H11NaO5S |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride |
| SMILES | Cc1cc(C(=O)O)c(C)c(S(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C9H10O5S.Na.H/c1-5-3-7(9(10)11)6(2)8(4-5)15(12,13)14;;/h3-4H,1-2H3,(H,10,11)(H,12,13,14);;/q;+1;-1 |
| InChIKey | WJMDEVBYUKDNGF-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride?
The IUPAC name of sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride (CID 173226136) is sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride.
What is the SMILES notation for sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride?
The canonical SMILES for sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride is Cc1cc(C(=O)O)c(C)c(S(=O)(=O)O)c1.[H-].[Na+].
What is the InChIKey of sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride?
The InChIKey is WJMDEVBYUKDNGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O5S.Na.H/c1-5-3-7(9(10)11)6(2)8(4-5)15(12,13)14;;/h3-4H,1-2H3,(H,10,11)(H,12,13,14);;/q;+1;-1.
What are the key properties of sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride?
sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride has a molecular weight of 254.24 g/mol, XLogP of -1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2,5-dimethyl-3-sulfobenzoic acid;hydride is sourced from PubChem (CID 173226136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).