C26H30Cl2N2OSi — CID 173226860
[4-(4,6-dichloro-2-methylpyrimidin-5-yl)-2,2-dimethylhept-6-en-3-yl]oxy-diphenylsilane (PubChem CID 173226860) has the molecular formula C26H30Cl2N2OSi and a molecular weight of 485.53 g/mol. Its IUPAC name is [4-(4,6-dichloro-2-methylpyrimidin-5-yl)-2,2-dimethylhept-6-en-3-yl]oxy-diphenylsilane.
| Compound Name | [4-(4,6-dichloro-2-methylpyrimidin-5-yl)-2,2-dimethylhept-6-en-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 173226860 |
| Molecular Formula | C26H30Cl2N2OSi |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [4-(4,6-dichloro-2-methylpyrimidin-5-yl)-2,2-dimethylhept-6-en-3-yl]oxy-diphenylsilane |
| SMILES | C=CCC(c1c(Cl)nc(C)nc1Cl)C(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H30Cl2N2OSi/c1-6-13-21(22-24(27)29-18(2)30-25(22)28)23(26(3,4)5)31-32(19-14-9-7-10-15-19)20-16-11-8-12-17-20/h6-12,14-17,21,23,32H,1,13H2,2-5H3 |
| InChIKey | VKCAMZUKTGECMR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|