C25H22F3N5O3 — CID 173227110
[[amino-[4-[5-[(2R)-2-amino-3-(1H-indol-3-yl)propoxy]-3-pyridinyl]phenyl]methylidene]amino] 2,2,2-trifluoroacetate (PubChem CID 173227110) has the molecular formula C25H22F3N5O3 and a molecular weight of 497.48 g/mol. Its IUPAC name is [[amino-[4-[5-[(2R)-2-amino-3-(1H-indol-3-yl)propoxy]-3-pyridinyl]phenyl]methylidene]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[amino-[4-[5-[(2R)-2-amino-3-(1H-indol-3-yl)propoxy]-3-pyridinyl]phenyl]methylidene]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 173227110 |
| Molecular Formula | C25H22F3N5O3 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | [[amino-[4-[5-[(2R)-2-amino-3-(1H-indol-3-yl)propoxy]-3-pyridinyl]phenyl]methylidene]amino] 2,2,2-trifluoroacetate |
| SMILES | NC(=NOC(=O)C(F)(F)F)c1ccc(-c2cncc(OC[C@H](N)Cc3c[nH]c4ccccc34)c2)cc1 |
| InChI | InChI=1S/C25H22F3N5O3/c26-25(27,28)24(34)36-33-23(30)16-7-5-15(6-8-16)17-10-20(13-31-11-17)35-14-19(29)9-18-12-32-22-4-2-1-3-21(18)22/h1-8,10-13,19,32H,9,14,29H2,(H2,30,33)/t19-/m1/s1 |
| InChIKey | IEWFTAJHIKATLI-LJQANCHMSA-N |
| XLogP | 3.90 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|