C20H30O5Si — CID 173227444
2-[[(2S,3R)-3-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]acetic acid (PubChem CID 173227444) has the molecular formula C20H30O5Si and a molecular weight of 378.54 g/mol. Its IUPAC name is 2-[[(2S,3R)-3-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]acetic acid.
| Compound Name | 2-[[(2S,3R)-3-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 173227444 |
| Molecular Formula | C20H30O5Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-[[(2S,3R)-3-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]acetic acid |
| SMILES | C[Si](C)(C)C#CC=CC=C[C@H]1OC2(CCCCC2)O[C@H]1COCC(=O)O |
| InChI | InChI=1S/C20H30O5Si/c1-26(2,3)14-10-5-4-7-11-17-18(15-23-16-19(21)22)25-20(24-17)12-8-6-9-13-20/h4-5,7,11,17-18H,6,8-9,12-13,15-16H2,1-3H3,(H,21,22)/t17-,18+/m1/s1 |
| InChIKey | NFYJDXXQOUJTHD-MSOLQXFVSA-N |
| XLogP | 3.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|