C12H21FNO15P3S — CID 173228470
2-(5-fluoro-1,3-benzothiazol-2-yl)-5-methyloxolane-3,4-diol;phosphoric acid (PubChem CID 173228470) has the molecular formula C12H21FNO15P3S and a molecular weight of 563.28 g/mol. Its IUPAC name is 2-(5-fluoro-1,3-benzothiazol-2-yl)-5-methyloxolane-3,4-diol;phosphoric acid.
| Compound Name | 2-(5-fluoro-1,3-benzothiazol-2-yl)-5-methyloxolane-3,4-diol;phosphoric acid |
|---|---|
| PubChem CID | 173228470 |
| Molecular Formula | C12H21FNO15P3S |
| Molecular Weight | 563.28 g/mol |
| Exact Mass | 562.98 |
| IUPAC Name | 2-(5-fluoro-1,3-benzothiazol-2-yl)-5-methyloxolane-3,4-diol;phosphoric acid |
| SMILES | CC1OC(c2nc3cc(F)ccc3s2)C(O)C1O.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C12H12FNO3S.3H3O4P/c1-5-9(15)10(16)11(17-5)12-14-7-4-6(13)2-3-8(7)18-12;3*1-5(2,3)4/h2-5,9-11,15-16H,1H3;3*(H3,1,2,3,4) |
| InChIKey | MJGYAAJLCKAXGF-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 295.86 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.28 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|