About CID 173228583
CID 173228583 (PubChem CID 173228583) has the molecular formula C38H58O3Si2
and a molecular weight of 619.05 g/mol.
Molecular Properties
| Compound Name | CID 173228583 |
| PubChem CID | 173228583 |
| Molecular Formula | C38H58O3Si2 |
| Molecular Weight | 619.05 g/mol |
| Exact Mass | 618.39 |
| IUPAC Name | — |
| SMILES | CCC(O)(C=CC=C(C)c1cccc(C=Cc2ccc(C(O[Si](C)C)C(C)(C)C)c(C(O[Si](C)C)C(C)(C)C)c2)c1)CC |
| InChI | InChI=1S/C38H58O3Si2/c1-14-38(39,15-2)25-17-18-28(3)31-20-16-19-29(26-31)21-22-30-23-24-32(34(36(4,5)6)40-42(10)11)33(27-30)35(37(7,8)9)41-43(12)13/h16-27,34-35,39H,14-15H2,1-13H3 |
| InChIKey | WNZQILVMUYOUJY-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 619.05 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 173228583 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173228583?
The IUPAC name of CID 173228583 (CID 173228583) is not available.
What is the SMILES notation for CID 173228583?
The canonical SMILES for CID 173228583 is CCC(O)(C=CC=C(C)c1cccc(C=Cc2ccc(C(O[Si](C)C)C(C)(C)C)c(C(O[Si](C)C)C(C)(C)C)c2)c1)CC.
What is the InChIKey of CID 173228583?
The InChIKey is WNZQILVMUYOUJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H58O3Si2/c1-14-38(39,15-2)25-17-18-28(3)31-20-16-19-29(26-31)21-22-30-23-24-32(34(36(4,5)6)40-42(10)11)33(27-30)35(37(7,8)9)41-43(12)13/h16-27,34-35,39H,14-15H2,1-13H3.
What are the key properties of CID 173228583?
CID 173228583 has a molecular weight of 619.05 g/mol, XLogP of 11.08, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173228583 is sourced from PubChem (CID 173228583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).