C14H15F17OSi — CID 173228621
(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12-heptadecafluoro-3,3-dimethyldodecan-2-yl)oxysilane (PubChem CID 173228621) has the molecular formula C14H15F17OSi and a molecular weight of 550.33 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12-heptadecafluoro-3,3-dimethyldodecan-2-yl)oxysilane.
| Compound Name | (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12-heptadecafluoro-3,3-dimethyldodecan-2-yl)oxysilane |
|---|---|
| PubChem CID | 173228621 |
| Molecular Formula | C14H15F17OSi |
| Molecular Weight | 550.33 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12-heptadecafluoro-3,3-dimethyldodecan-2-yl)oxysilane |
| SMILES | CC(O[SiH3])C(C)(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C14H15F17OSi/c1-4(32-33)7(2,3)9(20,21)11(24,25)13(28,29)14(30,31)12(26,27)10(22,23)8(18,19)5(15)6(16)17/h4-6H,1-3,33H3 |
| InChIKey | UWRYJECBZWUKGS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|