C13H13F17OSi — CID 173228703
(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11-heptadecafluoro-2,2-dimethylundecoxy)silane (PubChem CID 173228703) has the molecular formula C13H13F17OSi and a molecular weight of 536.30 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11-heptadecafluoro-2,2-dimethylundecoxy)silane.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11-heptadecafluoro-2,2-dimethylundecoxy)silane |
|---|---|
| PubChem CID | 173228703 |
| Molecular Formula | C13H13F17OSi |
| Molecular Weight | 536.30 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11-heptadecafluoro-2,2-dimethylundecoxy)silane |
| SMILES | CC(C)(CO[SiH3])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C13H13F17OSi/c1-6(2,3-31-32)8(19,20)10(23,24)12(27,28)13(29,30)11(25,26)9(21,22)7(17,18)4(14)5(15)16/h4-5H,3H2,1-2,32H3 |
| InChIKey | KILXOIORJNAKLZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.30 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|