C16H28Ru — CID 173228817
bis((3E)-octa-1,3-diene);ruthenium (PubChem CID 173228817) has the molecular formula C16H28Ru and a molecular weight of 321.47 g/mol. Its IUPAC name is bis((3E)-octa-1,3-diene);ruthenium.
| Compound Name | bis((3E)-octa-1,3-diene);ruthenium |
|---|---|
| PubChem CID | 173228817 |
| Molecular Formula | C16H28Ru |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | bis((3E)-octa-1,3-diene);ruthenium |
| SMILES | C=C/C=C/CCCC.C=C/C=C/CCCC.[Ru] |
| InChI | InChI=1S/2C8H14.Ru/c2*1-3-5-7-8-6-4-2;/h2*3,5,7H,1,4,6,8H2,2H3;/b2*7-5+; |
| InChIKey | YCJABZQCRHJPDI-XXXYRMOLSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|