C45H55Si2Zr- — CID 173229403
benzhydrylidenezirconium;(2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3-trimethylsilyl-9H-fluoren-9-id-4-yl)-trimethylsilane (PubChem CID 173229403) has the molecular formula C45H55Si2Zr- and a molecular weight of 743.33 g/mol. Its IUPAC name is benzhydrylidenezirconium;(2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3-trimethylsilyl-9H-fluoren-9-id-4-yl)-trimethylsilane.
| Compound Name | benzhydrylidenezirconium;(2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3-trimethylsilyl-9H-fluoren-9-id-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 173229403 |
| Molecular Formula | C45H55Si2Zr- |
| Molecular Weight | 743.33 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | benzhydrylidenezirconium;(2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3-trimethylsilyl-9H-fluoren-9-id-4-yl)-trimethylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)[cH-]c1c(C3=CC=CC3)c(C(C)(C)C)c([Si](C)(C)C)c([Si](C)(C)C)c12.[Zr]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H45Si2.C13H10.Zr/c1-31(2,3)23-17-18-24-22(19-23)20-25-26(21-15-13-14-16-21)28(32(4,5)6)30(34(10,11)12)29(27(24)25)33(7,8)9;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h13-15,17-20H,16H2,1-12H3;1-10H;/q-1;; |
| InChIKey | XDFYLPRPQMPNLN-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.33 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|