About barium(2+);carbonic acid;hydroxymethanone
barium(2+);carbonic acid;hydroxymethanone (PubChem CID 173229529) has the molecular formula C3H4BaO7
and a molecular weight of 289.39 g/mol. Its IUPAC name is barium(2+);carbonic acid;hydroxymethanone.
Molecular Properties
| Compound Name | barium(2+);carbonic acid;hydroxymethanone |
| PubChem CID | 173229529 |
| Molecular Formula | C3H4BaO7 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.90 |
| IUPAC Name | barium(2+);carbonic acid;hydroxymethanone |
| SMILES | O=C(O)O.O=[C-]O.O=[C-]O.[Ba+2] |
| InChI | InChI=1S/CH2O3.2CHO2.Ba/c2-1(3)4;2*2-1-3;/h(H2,2,3,4);2*(H,2,3);/q;2*-1;+2 |
| InChIKey | SNLGRTNQAKXGQN-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);carbonic acid;hydroxymethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);carbonic acid;hydroxymethanone?
The IUPAC name of barium(2+);carbonic acid;hydroxymethanone (CID 173229529) is barium(2+);carbonic acid;hydroxymethanone.
What is the SMILES notation for barium(2+);carbonic acid;hydroxymethanone?
The canonical SMILES for barium(2+);carbonic acid;hydroxymethanone is O=C(O)O.O=[C-]O.O=[C-]O.[Ba+2].
What is the InChIKey of barium(2+);carbonic acid;hydroxymethanone?
The InChIKey is SNLGRTNQAKXGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.2CHO2.Ba/c2-1(3)4;2*2-1-3;/h(H2,2,3,4);2*(H,2,3);/q;2*-1;+2.
What are the key properties of barium(2+);carbonic acid;hydroxymethanone?
barium(2+);carbonic acid;hydroxymethanone has a molecular weight of 289.39 g/mol, XLogP of -0.94, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);carbonic acid;hydroxymethanone is sourced from PubChem (CID 173229529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).