C57H51Zr- — CID 173229568
benzhydrylidenezirconium;2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3,4,5-triphenyl-9H-fluoren-9-ide (PubChem CID 173229568) has the molecular formula C57H51Zr- and a molecular weight of 827.26 g/mol. Its IUPAC name is benzhydrylidenezirconium;2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3,4,5-triphenyl-9H-fluoren-9-ide.
| Compound Name | benzhydrylidenezirconium;2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3,4,5-triphenyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 173229568 |
| Molecular Formula | C57H51Zr- |
| Molecular Weight | 827.26 g/mol |
| Exact Mass | 825.30 |
| IUPAC Name | benzhydrylidenezirconium;2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3,4,5-triphenyl-9H-fluoren-9-ide |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c2c(c1)[cH-]c1c(C3=CC=CC3)c(C(C)(C)C)c(-c3ccccc3)c(-c3ccccc3)c12.[Zr]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H41.C13H10.Zr/c1-43(2,3)34-26-33-27-36-38(30-24-16-17-25-30)42(44(4,5)6)40(32-22-14-9-15-23-32)39(31-20-12-8-13-21-31)41(36)37(33)35(28-34)29-18-10-7-11-19-29;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h7-24,26-28H,25H2,1-6H3;1-10H;/q-1;; |
| InChIKey | SUSLCZONZSMWQR-UHFFFAOYSA-N |
| XLogP | 15.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.26 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|