phosphane;sulfurous acid

H8O3P2S — CID 173229936

IUPACphosphane;sulfurous acid
SMILESO=S(O)O.P.P
InChIInChI=1S/H2O3S.2H3P/c1-4(2)3;;/h(H2,1,2,3);2*1H3
InChIKeyJIWNDDXSAIWYEZ-UHFFFAOYSA-N
MW150.08 g/mol
LogP-0.20
Rot. Bonds

About phosphane;sulfurous acid

phosphane;sulfurous acid (PubChem CID 173229936) has the molecular formula H8O3P2S and a molecular weight of 150.08 g/mol. Its IUPAC name is phosphane;sulfurous acid.

Molecular Properties

Compound Namephosphane;sulfurous acid
PubChem CID173229936
Molecular FormulaH8O3P2S
Molecular Weight150.08 g/mol
Exact Mass149.97
IUPAC Namephosphane;sulfurous acid
SMILESO=S(O)O.P.P
InChIInChI=1S/H2O3S.2H3P/c1-4(2)3;;/h(H2,1,2,3);2*1H3
InChIKeyJIWNDDXSAIWYEZ-UHFFFAOYSA-N
XLogP-0.20
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.08
LogP ≤ 5-0.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze phosphane;sulfurous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phosphane;sulfurous acid?
The IUPAC name of phosphane;sulfurous acid (CID 173229936) is phosphane;sulfurous acid.
What is the SMILES notation for phosphane;sulfurous acid?
The canonical SMILES for phosphane;sulfurous acid is O=S(O)O.P.P.
What is the InChIKey of phosphane;sulfurous acid?
The InChIKey is JIWNDDXSAIWYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/H2O3S.2H3P/c1-4(2)3;;/h(H2,1,2,3);2*1H3.
What are the key properties of phosphane;sulfurous acid?
phosphane;sulfurous acid has a molecular weight of 150.08 g/mol, XLogP of -0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;sulfurous acid is sourced from PubChem (CID 173229936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).