About phosphane;sulfurous acid
phosphane;sulfurous acid (PubChem CID 173229936) has the molecular formula H8O3P2S
and a molecular weight of 150.08 g/mol. Its IUPAC name is phosphane;sulfurous acid.
Molecular Properties
| Compound Name | phosphane;sulfurous acid |
| PubChem CID | 173229936 |
| Molecular Formula | H8O3P2S |
| Molecular Weight | 150.08 g/mol |
| Exact Mass | 149.97 |
| IUPAC Name | phosphane;sulfurous acid |
| SMILES | O=S(O)O.P.P |
| InChI | InChI=1S/H2O3S.2H3P/c1-4(2)3;;/h(H2,1,2,3);2*1H3 |
| InChIKey | JIWNDDXSAIWYEZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.08 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze phosphane;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphane;sulfurous acid?
The IUPAC name of phosphane;sulfurous acid (CID 173229936) is phosphane;sulfurous acid.
What is the SMILES notation for phosphane;sulfurous acid?
The canonical SMILES for phosphane;sulfurous acid is O=S(O)O.P.P.
What is the InChIKey of phosphane;sulfurous acid?
The InChIKey is JIWNDDXSAIWYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/H2O3S.2H3P/c1-4(2)3;;/h(H2,1,2,3);2*1H3.
What are the key properties of phosphane;sulfurous acid?
phosphane;sulfurous acid has a molecular weight of 150.08 g/mol, XLogP of -0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;sulfurous acid is sourced from PubChem (CID 173229936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).