C9H19GaO2 — CID 173230455
1,3-dimethylcyclohexane-1-carboxylic acid;gallane (PubChem CID 173230455) has the molecular formula C9H19GaO2 and a molecular weight of 228.97 g/mol. Its IUPAC name is 1,3-dimethylcyclohexane-1-carboxylic acid;gallane.
| Compound Name | 1,3-dimethylcyclohexane-1-carboxylic acid;gallane |
|---|---|
| PubChem CID | 173230455 |
| Molecular Formula | C9H19GaO2 |
| Molecular Weight | 228.97 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1,3-dimethylcyclohexane-1-carboxylic acid;gallane |
| SMILES | CC1CCCC(C)(C(=O)O)C1.[GaH3] |
| InChI | InChI=1S/C9H16O2.Ga.3H/c1-7-4-3-5-9(2,6-7)8(10)11;;;;/h7H,3-6H2,1-2H3,(H,10,11);;;; |
| InChIKey | KFYKEOMYTJQXNS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.97 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |