About 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane
1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane (PubChem CID 173230586) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane.
Analyze 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane?
The IUPAC name of 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane (CID 173230586) is 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane.
What is the SMILES notation for 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane?
The canonical SMILES for 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane is CC1CCCC(C)(C2(C)CCCCC2C)C1.
What is the InChIKey of 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane?
The InChIKey is QYMHGQYQNRVTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30/c1-13-8-7-10-15(3,12-13)16(4)11-6-5-9-14(16)2/h13-14H,5-12H2,1-4H3.
What are the key properties of 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane?
1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane has a molecular weight of 222.42 g/mol, XLogP of 5.42, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dimethylcyclohexyl)-1,3-dimethylcyclohexane is sourced from PubChem (CID 173230586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).