About 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan
2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan (PubChem CID 173231916) has the molecular formula C12H10ClFO
and a molecular weight of 224.66 g/mol. Its IUPAC name is 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan.
Molecular Properties
| Compound Name | 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan |
| PubChem CID | 173231916 |
| Molecular Formula | C12H10ClFO |
| Molecular Weight | 224.66 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan |
| SMILES | Cc1c(-c2ccco2)cc(F)c(Cl)c1C |
| InChI | InChI=1S/C12H10ClFO/c1-7-8(2)12(13)10(14)6-9(7)11-4-3-5-15-11/h3-6H,1-2H3 |
| InChIKey | MUFYVIKSIOYXFN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan?
The IUPAC name of 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan (CID 173231916) is 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan.
What is the SMILES notation for 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan?
The canonical SMILES for 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan is Cc1c(-c2ccco2)cc(F)c(Cl)c1C.
What is the InChIKey of 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan?
The InChIKey is MUFYVIKSIOYXFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClFO/c1-7-8(2)12(13)10(14)6-9(7)11-4-3-5-15-11/h3-6H,1-2H3.
What are the key properties of 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan?
2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan has a molecular weight of 224.66 g/mol, XLogP of 4.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-5-fluoro-2,3-dimethylphenyl)furan is sourced from PubChem (CID 173231916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).