About 5-bromo-2,3,4-trimethyl-1H-indene
5-bromo-2,3,4-trimethyl-1H-indene (PubChem CID 173231939) has the molecular formula C12H13Br
and a molecular weight of 237.14 g/mol. Its IUPAC name is 5-bromo-2,3,4-trimethyl-1H-indene.
Molecular Properties
| Compound Name | 5-bromo-2,3,4-trimethyl-1H-indene |
| PubChem CID | 173231939 |
| Molecular Formula | C12H13Br |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 5-bromo-2,3,4-trimethyl-1H-indene |
| SMILES | CC1=C(C)c2c(ccc(Br)c2C)C1 |
| InChI | InChI=1S/C12H13Br/c1-7-6-10-4-5-11(13)9(3)12(10)8(7)2/h4-5H,6H2,1-3H3 |
| InChIKey | QYTMKWPIGJQKLV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-bromo-2,3,4-trimethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,3,4-trimethyl-1H-indene?
The IUPAC name of 5-bromo-2,3,4-trimethyl-1H-indene (CID 173231939) is 5-bromo-2,3,4-trimethyl-1H-indene.
What is the SMILES notation for 5-bromo-2,3,4-trimethyl-1H-indene?
The canonical SMILES for 5-bromo-2,3,4-trimethyl-1H-indene is CC1=C(C)c2c(ccc(Br)c2C)C1.
What is the InChIKey of 5-bromo-2,3,4-trimethyl-1H-indene?
The InChIKey is QYTMKWPIGJQKLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Br/c1-7-6-10-4-5-11(13)9(3)12(10)8(7)2/h4-5H,6H2,1-3H3.
What are the key properties of 5-bromo-2,3,4-trimethyl-1H-indene?
5-bromo-2,3,4-trimethyl-1H-indene has a molecular weight of 237.14 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3,4-trimethyl-1H-indene is sourced from PubChem (CID 173231939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).