About [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate
[3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate (PubChem CID 173232100) has the molecular formula C13H25NO4Si
and a molecular weight of 287.43 g/mol. Its IUPAC name is [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate.
Molecular Properties
| Compound Name | [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate |
| PubChem CID | 173232100 |
| Molecular Formula | C13H25NO4Si |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)OC1NC(=O)C1C(CO[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO4Si/c1-8(15)18-12-10(11(16)14-12)9(13(2,3)4)7-17-19(5)6/h9-10,12,19H,7H2,1-6H3,(H,14,16) |
| InChIKey | YRHXOMKGQHQFJF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate?
The IUPAC name of [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate (CID 173232100) is [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate.
What is the SMILES notation for [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate?
The canonical SMILES for [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate is CC(=O)OC1NC(=O)C1C(CO[SiH](C)C)C(C)(C)C.
What is the InChIKey of [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate?
The InChIKey is YRHXOMKGQHQFJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO4Si/c1-8(15)18-12-10(11(16)14-12)9(13(2,3)4)7-17-19(5)6/h9-10,12,19H,7H2,1-6H3,(H,14,16).
What are the key properties of [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate?
[3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate has a molecular weight of 287.43 g/mol, XLogP of 1.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-oxoazetidin-2-yl] acetate is sourced from PubChem (CID 173232100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).