About 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde
6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 173232146) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 173232146 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CCNC=C1CC=CC=C1C=O |
| InChI | InChI=1S/C10H13NO/c1-2-11-7-9-5-3-4-6-10(9)8-12/h3-4,6-8,11H,2,5H2,1H3 |
| InChIKey | NXRAVCCLJMFAHD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde (CID 173232146) is 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde is CCNC=C1CC=CC=C1C=O.
What is the InChIKey of 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is NXRAVCCLJMFAHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-2-11-7-9-5-3-4-6-10(9)8-12/h3-4,6-8,11H,2,5H2,1H3.
What are the key properties of 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde?
6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 163.22 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(ethylaminomethylidene)cyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 173232146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).