C19H21ClN4O6S — CID 173232363
but-2-enedioic acid;2-[(3-chlorobenzoyl)amino]-N-[2-(dimethylamino)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 173232363) has the molecular formula C19H21ClN4O6S and a molecular weight of 468.92 g/mol. Its IUPAC name is but-2-enedioic acid;2-[(3-chlorobenzoyl)amino]-N-[2-(dimethylamino)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | but-2-enedioic acid;2-[(3-chlorobenzoyl)amino]-N-[2-(dimethylamino)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 173232363 |
| Molecular Formula | C19H21ClN4O6S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | but-2-enedioic acid;2-[(3-chlorobenzoyl)amino]-N-[2-(dimethylamino)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)CCNC(=O)c1csc(NC(=O)c2cccc(Cl)c2)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H17ClN4O2S.C4H4O4/c1-20(2)7-6-17-14(22)12-9-23-15(18-12)19-13(21)10-4-3-5-11(16)8-10;5-3(6)1-2-4(7)8/h3-5,8-9H,6-7H2,1-2H3,(H,17,22)(H,18,19,21);1-2H,(H,5,6)(H,7,8) |
| InChIKey | ZVXKWLBXAKFUPJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|