C11H24N2 — CID 173232386
1-N'-cyclopentyl-1-N-propylpropane-1,1-diamine (PubChem CID 173232386) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-N'-cyclopentyl-1-N-propylpropane-1,1-diamine.
| Compound Name | 1-N'-cyclopentyl-1-N-propylpropane-1,1-diamine |
|---|---|
| PubChem CID | 173232386 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-N'-cyclopentyl-1-N-propylpropane-1,1-diamine |
| SMILES | CCCNC(CC)NC1CCCC1 |
| InChI | InChI=1S/C11H24N2/c1-3-9-12-11(4-2)13-10-7-5-6-8-10/h10-13H,3-9H2,1-2H3 |
| InChIKey | ZXPZSNISFYQYHN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|