C15H18N2O2 — CID 173232405
2-(cyclobutanecarbonyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 173232405) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(cyclobutanecarbonyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | 2-(cyclobutanecarbonyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 173232405 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-(cyclobutanecarbonyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | NC(=O)C1c2ccccc2CCN1C(=O)C1CCC1 |
| InChI | InChI=1S/C15H18N2O2/c16-14(18)13-12-7-2-1-4-10(12)8-9-17(13)15(19)11-5-3-6-11/h1-2,4,7,11,13H,3,5-6,8-9H2,(H2,16,18) |
| InChIKey | HGFJMFLLULJFPX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |