C35H37N2NaO5S — CID 173232615
sodium;hydride;5-[[4-[[(2S)-1-[(2,4,6,7-tetramethyl-5-phenylmethoxy-1-benzofuran-3-yl)methyl]pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 173232615) has the molecular formula C35H37N2NaO5S and a molecular weight of 620.75 g/mol. Its IUPAC name is sodium;hydride;5-[[4-[[(2S)-1-[(2,4,6,7-tetramethyl-5-phenylmethoxy-1-benzofuran-3-yl)methyl]pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | sodium;hydride;5-[[4-[[(2S)-1-[(2,4,6,7-tetramethyl-5-phenylmethoxy-1-benzofuran-3-yl)methyl]pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 173232615 |
| Molecular Formula | C35H37N2NaO5S |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | sodium;hydride;5-[[4-[[(2S)-1-[(2,4,6,7-tetramethyl-5-phenylmethoxy-1-benzofuran-3-yl)methyl]pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1oc2c(C)c(C)c(OCc3ccccc3)c(C)c2c1CN1CCC[C@H]1COc1ccc(C=C2SC(=O)NC2=O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C35H36N2O5S.Na.H/c1-21-22(2)33-31(23(3)32(21)41-19-26-9-6-5-7-10-26)29(24(4)42-33)18-37-16-8-11-27(37)20-40-28-14-12-25(13-15-28)17-30-34(38)36-35(39)43-30;;/h5-7,9-10,12-15,17,27H,8,11,16,18-20H2,1-4H3,(H,36,38,39);;/q;+1;-1/t27-;;/m0../s1 |
| InChIKey | NFSHXZCPEXJIRO-LPCSYZHESA-N |
| XLogP | 4.73 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|