C30H46N4O5 — CID 173232881
(2R,3S)-3-[[[(2R)-2-aminopropanoyl]-cyclopentylamino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide (PubChem CID 173232881) has the molecular formula C30H46N4O5 and a molecular weight of 542.72 g/mol. Its IUPAC name is (2R,3S)-3-[[[(2R)-2-aminopropanoyl]-cyclopentylamino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide.
| Compound Name | (2R,3S)-3-[[[(2R)-2-aminopropanoyl]-cyclopentylamino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 173232881 |
| Molecular Formula | C30H46N4O5 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | (2R,3S)-3-[[[(2R)-2-aminopropanoyl]-cyclopentylamino]carbamoyl]-5-methyl-N-(oxan-2-yloxy)-2-(3-phenylprop-2-enyl)hexanamide |
| SMILES | CC(C)CC(C(=O)NN(C(=O)[C@@H](C)N)C1CCCC1)C(CC=Cc1ccccc1)C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C30H46N4O5/c1-21(2)20-26(28(35)32-34(30(37)22(3)31)24-15-7-8-16-24)25(17-11-14-23-12-5-4-6-13-23)29(36)33-39-27-18-9-10-19-38-27/h4-6,11-14,21-22,24-27H,7-10,15-20,31H2,1-3H3,(H,32,35)(H,33,36)/t22-,25?,26?,27?/m1/s1 |
| InChIKey | SYVAXQRNNCSSQU-VUJBHTJXSA-N |
| XLogP | 4.09 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|