About 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole
3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole (PubChem CID 173233148) has the molecular formula C22H25NO
and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole.
Molecular Properties
| Compound Name | 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole |
| PubChem CID | 173233148 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole |
| SMILES | Cc1cccc(C)c1Oc1ccc2[nH]cc(C3CCCCC3)c2c1 |
| InChI | InChI=1S/C22H25NO/c1-15-7-6-8-16(2)22(15)24-18-11-12-21-19(13-18)20(14-23-21)17-9-4-3-5-10-17/h6-8,11-14,17,23H,3-5,9-10H2,1-2H3 |
| InChIKey | VVZJBMBUQXKNAB-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole?
The IUPAC name of 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole (CID 173233148) is 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole.
What is the SMILES notation for 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole?
The canonical SMILES for 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole is Cc1cccc(C)c1Oc1ccc2[nH]cc(C3CCCCC3)c2c1.
What is the InChIKey of 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole?
The InChIKey is VVZJBMBUQXKNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO/c1-15-7-6-8-16(2)22(15)24-18-11-12-21-19(13-18)20(14-23-21)17-9-4-3-5-10-17/h6-8,11-14,17,23H,3-5,9-10H2,1-2H3.
What are the key properties of 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole?
3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole has a molecular weight of 319.45 g/mol, XLogP of 6.62, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-5-(2,6-dimethylphenoxy)-1H-indole is sourced from PubChem (CID 173233148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).