About 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine
1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine (PubChem CID 173233295) has the molecular formula C10H14BrN
and a molecular weight of 228.13 g/mol. Its IUPAC name is 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine |
| PubChem CID | 173233295 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine |
| SMILES | BrC1=CC(N2CCCC2)=CCC1 |
| InChI | InChI=1S/C10H14BrN/c11-9-4-3-5-10(8-9)12-6-1-2-7-12/h5,8H,1-4,6-7H2 |
| InChIKey | ZSXNOYMCXXKTOB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine?
The IUPAC name of 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine (CID 173233295) is 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine.
What is the SMILES notation for 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine?
The canonical SMILES for 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine is BrC1=CC(N2CCCC2)=CCC1.
What is the InChIKey of 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine?
The InChIKey is ZSXNOYMCXXKTOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN/c11-9-4-3-5-10(8-9)12-6-1-2-7-12/h5,8H,1-4,6-7H2.
What are the key properties of 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine?
1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine has a molecular weight of 228.13 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromocyclohexa-1,5-dien-1-yl)pyrrolidine is sourced from PubChem (CID 173233295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).