C14H14Cl2O2 — CID 173233574
1,2-dichloro-4-(2,3-dimethoxycyclohexa-1,3-dien-1-yl)benzene (PubChem CID 173233574) has the molecular formula C14H14Cl2O2 and a molecular weight of 285.17 g/mol. Its IUPAC name is 1,2-dichloro-4-(2,3-dimethoxycyclohexa-1,3-dien-1-yl)benzene.
| Compound Name | 1,2-dichloro-4-(2,3-dimethoxycyclohexa-1,3-dien-1-yl)benzene |
|---|---|
| PubChem CID | 173233574 |
| Molecular Formula | C14H14Cl2O2 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1,2-dichloro-4-(2,3-dimethoxycyclohexa-1,3-dien-1-yl)benzene |
| SMILES | COC1=CCCC(c2ccc(Cl)c(Cl)c2)=C1OC |
| InChI | InChI=1S/C14H14Cl2O2/c1-17-13-5-3-4-10(14(13)18-2)9-6-7-11(15)12(16)8-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | HKXKRTKTRNHWFP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |