C30H49F2NO4Si — CID 173233581
1-fluorobutyl (2R,4R,5R)-5-(2-acetylpentyl)-1-benzyl-4-(1-dimethylsilyloxy-2-fluoropentyl)pyrrolidine-2-carboxylate (PubChem CID 173233581) has the molecular formula C30H49F2NO4Si and a molecular weight of 553.81 g/mol. Its IUPAC name is 1-fluorobutyl (2R,4R,5R)-5-(2-acetylpentyl)-1-benzyl-4-(1-dimethylsilyloxy-2-fluoropentyl)pyrrolidine-2-carboxylate.
| Compound Name | 1-fluorobutyl (2R,4R,5R)-5-(2-acetylpentyl)-1-benzyl-4-(1-dimethylsilyloxy-2-fluoropentyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 173233581 |
| Molecular Formula | C30H49F2NO4Si |
| Molecular Weight | 553.81 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | 1-fluorobutyl (2R,4R,5R)-5-(2-acetylpentyl)-1-benzyl-4-(1-dimethylsilyloxy-2-fluoropentyl)pyrrolidine-2-carboxylate |
| SMILES | CCCC(F)OC(=O)[C@H]1C[C@@H](C(O[SiH](C)C)C(F)CCC)[C@@H](CC(CCC)C(C)=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H49F2NO4Si/c1-7-13-23(21(4)34)18-26-24(29(37-38(5)6)25(31)14-8-2)19-27(30(35)36-28(32)15-9-3)33(26)20-22-16-11-10-12-17-22/h10-12,16-17,23-29,38H,7-9,13-15,18-20H2,1-6H3/t23?,24-,25?,26-,27-,28?,29?/m1/s1 |
| InChIKey | JXRVROXFIHPTST-LSFFJHDVSA-N |
| XLogP | 6.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.81 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|