About 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride
3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride (PubChem CID 173234662) has the molecular formula C8H18ClNO2
and a molecular weight of 195.69 g/mol. Its IUPAC name is 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride.
Molecular Properties
| Compound Name | 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride |
| PubChem CID | 173234662 |
| Molecular Formula | C8H18ClNO2 |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride |
| SMILES | C=CCNC(CCO)CCO.Cl |
| InChI | InChI=1S/C8H17NO2.ClH/c1-2-5-9-8(3-6-10)4-7-11;/h2,8-11H,1,3-7H2;1H |
| InChIKey | SCSBVBFTQXJAHO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride?
The IUPAC name of 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride (CID 173234662) is 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride.
What is the SMILES notation for 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride?
The canonical SMILES for 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride is C=CCNC(CCO)CCO.Cl.
What is the InChIKey of 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride?
The InChIKey is SCSBVBFTQXJAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.ClH/c1-2-5-9-8(3-6-10)4-7-11;/h2,8-11H,1,3-7H2;1H.
What are the key properties of 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride?
3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride has a molecular weight of 195.69 g/mol, XLogP of 0.32, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(prop-2-enylamino)pentane-1,5-diol;hydrochloride is sourced from PubChem (CID 173234662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).