2-hexaphen-1-ylguanidine;nitrous acid

C27H20N4O2 — CID 173234673

IUPAC2-hexaphen-1-ylguanidine;nitrous acid
SMILESNC(N)=Nc1cccc2cc3ccc4cc5cc6ccccc6cc5cc4c3cc12.O=NO
InChIInChI=1S/C27H19N3.HNO2/c28-27(29)30-26-7-3-6-18-12-19-8-9-20-13-21-10-16-4-1-2-5-17(16)11-22(21)14-23(20)24(19)15-25(18)26;2-1-3/h1-15H,(H4,28,29,30);(H,2,3)
InChIKeyMPJZEPLRBZLGJR-UHFFFAOYSA-N
MW432.48 g/mol
LogP6.50
Rot. Bonds1

About 2-hexaphen-1-ylguanidine;nitrous acid

2-hexaphen-1-ylguanidine;nitrous acid (PubChem CID 173234673) has the molecular formula C27H20N4O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-hexaphen-1-ylguanidine;nitrous acid.

Molecular Properties

Compound Name2-hexaphen-1-ylguanidine;nitrous acid
PubChem CID173234673
Molecular FormulaC27H20N4O2
Molecular Weight432.48 g/mol
Exact Mass432.16
IUPAC Name2-hexaphen-1-ylguanidine;nitrous acid
SMILESNC(N)=Nc1cccc2cc3ccc4cc5cc6ccccc6cc5cc4c3cc12.O=NO
InChIInChI=1S/C27H19N3.HNO2/c28-27(29)30-26-7-3-6-18-12-19-8-9-20-13-21-10-16-4-1-2-5-17(16)11-22(21)14-23(20)24(19)15-25(18)26;2-1-3/h1-15H,(H4,28,29,30);(H,2,3)
InChIKeyMPJZEPLRBZLGJR-UHFFFAOYSA-N
XLogP6.50
TPSA114.06 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms33
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500432.48
LogP ≤ 56.50
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze 2-hexaphen-1-ylguanidine;nitrous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hexaphen-1-ylguanidine;nitrous acid?
The IUPAC name of 2-hexaphen-1-ylguanidine;nitrous acid (CID 173234673) is 2-hexaphen-1-ylguanidine;nitrous acid.
What is the SMILES notation for 2-hexaphen-1-ylguanidine;nitrous acid?
The canonical SMILES for 2-hexaphen-1-ylguanidine;nitrous acid is NC(N)=Nc1cccc2cc3ccc4cc5cc6ccccc6cc5cc4c3cc12.O=NO.
What is the InChIKey of 2-hexaphen-1-ylguanidine;nitrous acid?
The InChIKey is MPJZEPLRBZLGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19N3.HNO2/c28-27(29)30-26-7-3-6-18-12-19-8-9-20-13-21-10-16-4-1-2-5-17(16)11-22(21)14-23(20)24(19)15-25(18)26;2-1-3/h1-15H,(H4,28,29,30);(H,2,3).
What are the key properties of 2-hexaphen-1-ylguanidine;nitrous acid?
2-hexaphen-1-ylguanidine;nitrous acid has a molecular weight of 432.48 g/mol, XLogP of 6.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexaphen-1-ylguanidine;nitrous acid is sourced from PubChem (CID 173234673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).