C22H28F6OSi — CID 173235393
tert-butyl-cyclohexyl-[(1,2,3,4,6,7-hexafluoro-1H-inden-5-yl)oxy]-propan-2-ylsilane (PubChem CID 173235393) has the molecular formula C22H28F6OSi and a molecular weight of 450.54 g/mol. Its IUPAC name is tert-butyl-cyclohexyl-[(1,2,3,4,6,7-hexafluoro-1H-inden-5-yl)oxy]-propan-2-ylsilane.
| Compound Name | tert-butyl-cyclohexyl-[(1,2,3,4,6,7-hexafluoro-1H-inden-5-yl)oxy]-propan-2-ylsilane |
|---|---|
| PubChem CID | 173235393 |
| Molecular Formula | C22H28F6OSi |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | tert-butyl-cyclohexyl-[(1,2,3,4,6,7-hexafluoro-1H-inden-5-yl)oxy]-propan-2-ylsilane |
| SMILES | CC(C)[Si](Oc1c(F)c(F)c2c(c1F)C(F)=C(F)C2F)(C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C22H28F6OSi/c1-11(2)30(22(3,4)5,12-9-7-6-8-10-12)29-21-18(26)14-13(17(25)20(21)28)15(23)19(27)16(14)24/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | KPWZSDLWZYNRTA-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|