C32H48F6OSi2 — CID 173235717
cyclohexyl-[8-[diethyl(methyl)silyl]octyl]-(2,3,4,5,7,8-hexafluoronaphthalen-1-yl)oxy-propan-2-ylsilane (PubChem CID 173235717) has the molecular formula C32H48F6OSi2 and a molecular weight of 618.90 g/mol. Its IUPAC name is cyclohexyl-[8-[diethyl(methyl)silyl]octyl]-(2,3,4,5,7,8-hexafluoronaphthalen-1-yl)oxy-propan-2-ylsilane.
| Compound Name | cyclohexyl-[8-[diethyl(methyl)silyl]octyl]-(2,3,4,5,7,8-hexafluoronaphthalen-1-yl)oxy-propan-2-ylsilane |
|---|---|
| PubChem CID | 173235717 |
| Molecular Formula | C32H48F6OSi2 |
| Molecular Weight | 618.90 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | cyclohexyl-[8-[diethyl(methyl)silyl]octyl]-(2,3,4,5,7,8-hexafluoronaphthalen-1-yl)oxy-propan-2-ylsilane |
| SMILES | CC[Si](C)(CC)CCCCCCCC[Si](Oc1c(F)c(F)c(F)c2c(F)cc(F)c(F)c12)(C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C32H48F6OSi2/c1-6-40(5,7-2)19-15-10-8-9-11-16-20-41(22(3)4,23-17-13-12-14-18-23)39-32-27-26(29(36)30(37)31(32)38)24(33)21-25(34)28(27)35/h21-23H,6-20H2,1-5H3 |
| InChIKey | SRVORUYNQHBRQH-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.90 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|