About CID 173237034
CID 173237034 (PubChem CID 173237034) has the molecular formula HO3STi-
and a molecular weight of 128.94 g/mol.
Molecular Properties
| Compound Name | CID 173237034 |
| PubChem CID | 173237034 |
| Molecular Formula | HO3STi- |
| Molecular Weight | 128.94 g/mol |
| Exact Mass | 128.91 |
| IUPAC Name | — |
| SMILES | O=[S-](=O)O.[Ti] |
| InChI | InChI=1S/HO3S.Ti/c1-4(2)3;/h(H,1,2,3);/q-1; |
| InChIKey | HDQIYHRWNDMBKF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.94 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 173237034 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173237034?
The IUPAC name of CID 173237034 (CID 173237034) is not available.
What is the SMILES notation for CID 173237034?
The canonical SMILES for CID 173237034 is O=[S-](=O)O.[Ti].
What is the InChIKey of CID 173237034?
The InChIKey is HDQIYHRWNDMBKF-UHFFFAOYSA-N. The full InChI is InChI=1S/HO3S.Ti/c1-4(2)3;/h(H,1,2,3);/q-1;.
What are the key properties of CID 173237034?
CID 173237034 has a molecular weight of 128.94 g/mol, XLogP of -0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173237034 is sourced from PubChem (CID 173237034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).