About 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid
1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid (PubChem CID 173237062) has the molecular formula C15H16BrFN4O4S
and a molecular weight of 447.29 g/mol. Its IUPAC name is 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
| PubChem CID | 173237062 |
| Molecular Formula | C15H16BrFN4O4S |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.[H]/N=C(\N)N(O)N=Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C8H8BrFN4O.C7H8O3S/c9-6-3-5(1-2-7(6)10)4-13-14(15)8(11)12;1-6-2-4-7(5-3-6)11(8,9)10/h1-4,15H,(H3,11,12);2-5H,1H3,(H,8,9,10) |
| InChIKey | LFIMBIMORMMUIW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 140.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid?
The IUPAC name of 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid (CID 173237062) is 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid.
What is the SMILES notation for 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid?
The canonical SMILES for 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.[H]/N=C(\N)N(O)N=Cc1ccc(F)c(Br)c1.
What is the InChIKey of 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid?
The InChIKey is LFIMBIMORMMUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrFN4O.C7H8O3S/c9-6-3-5(1-2-7(6)10)4-13-14(15)8(11)12;1-6-2-4-7(5-3-6)11(8,9)10/h1-4,15H,(H3,11,12);2-5H,1H3,(H,8,9,10).
What are the key properties of 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid?
1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid has a molecular weight of 447.29 g/mol, XLogP of 2.75, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-bromo-4-fluorophenyl)methylideneamino]-1-hydroxyguanidine;4-methylbenzenesulfonic acid is sourced from PubChem (CID 173237062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).