About 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine
2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine (PubChem CID 173238507) has the molecular formula C6H4F6N2
and a molecular weight of 218.10 g/mol. Its IUPAC name is 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine |
| PubChem CID | 173238507 |
| Molecular Formula | C6H4F6N2 |
| Molecular Weight | 218.10 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine |
| SMILES | FC(F)(F)C1=CNC(C(F)(F)F)=NC1 |
| InChI | InChI=1S/C6H4F6N2/c7-5(8,9)3-1-13-4(14-2-3)6(10,11)12/h1H,2H2,(H,13,14) |
| InChIKey | SYTWDTCZXVPDPG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine?
The IUPAC name of 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine (CID 173238507) is 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine.
What is the SMILES notation for 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine?
The canonical SMILES for 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine is FC(F)(F)C1=CNC(C(F)(F)F)=NC1.
What is the InChIKey of 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine?
The InChIKey is SYTWDTCZXVPDPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F6N2/c7-5(8,9)3-1-13-4(14-2-3)6(10,11)12/h1H,2H2,(H,13,14).
What are the key properties of 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine?
2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine has a molecular weight of 218.10 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(trifluoromethyl)-1,4-dihydropyrimidine is sourced from PubChem (CID 173238507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).