C15H9F2NO4 — CID 173238633
2-(2,2-difluoro-1,3-benzodioxol-5-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 173238633) has the molecular formula C15H9F2NO4 and a molecular weight of 305.24 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 173238633 |
| Molecular Formula | C15H9F2NO4 |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2ccccc2OC1c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C15H9F2NO4/c16-15(17)21-11-6-5-8(7-12(11)22-15)13-14(19)18-9-3-1-2-4-10(9)20-13/h1-7,13H,(H,18,19) |
| InChIKey | GZONJHNQJUQUQX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |