C21H25Cl2NO4S — CID 173238965
6-[3-[[(2,4-dichlorophenyl)sulfonylamino]methyl]-2-bicyclo[2.2.2]octanyl]hexa-2,4-dienoic acid (PubChem CID 173238965) has the molecular formula C21H25Cl2NO4S and a molecular weight of 458.41 g/mol. Its IUPAC name is 6-[3-[[(2,4-dichlorophenyl)sulfonylamino]methyl]-2-bicyclo[2.2.2]octanyl]hexa-2,4-dienoic acid.
| Compound Name | 6-[3-[[(2,4-dichlorophenyl)sulfonylamino]methyl]-2-bicyclo[2.2.2]octanyl]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 173238965 |
| Molecular Formula | C21H25Cl2NO4S |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 6-[3-[[(2,4-dichlorophenyl)sulfonylamino]methyl]-2-bicyclo[2.2.2]octanyl]hexa-2,4-dienoic acid |
| SMILES | O=C(O)C=CC=CCC1C2CCC(CC2)C1CNS(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H25Cl2NO4S/c22-16-10-11-20(19(23)12-16)29(27,28)24-13-18-15-8-6-14(7-9-15)17(18)4-2-1-3-5-21(25)26/h1-3,5,10-12,14-15,17-18,24H,4,6-9,13H2,(H,25,26) |
| InChIKey | PZDXWAXBQAKLHZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|