C12H28ClNO — CID 173239320
N-(2,4-dimethyl-3-propan-2-ylpentan-3-yl)oxyethanamine;hydrochloride (PubChem CID 173239320) has the molecular formula C12H28ClNO and a molecular weight of 237.81 g/mol. Its IUPAC name is N-(2,4-dimethyl-3-propan-2-ylpentan-3-yl)oxyethanamine;hydrochloride.
| Compound Name | N-(2,4-dimethyl-3-propan-2-ylpentan-3-yl)oxyethanamine;hydrochloride |
|---|---|
| PubChem CID | 173239320 |
| Molecular Formula | C12H28ClNO |
| Molecular Weight | 237.81 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | N-(2,4-dimethyl-3-propan-2-ylpentan-3-yl)oxyethanamine;hydrochloride |
| SMILES | CCNOC(C(C)C)(C(C)C)C(C)C.Cl |
| InChI | InChI=1S/C12H27NO.ClH/c1-8-13-14-12(9(2)3,10(4)5)11(6)7;/h9-11,13H,8H2,1-7H3;1H |
| InChIKey | HDCIOSFRFCLOND-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|